About methyl N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)carbamate
methyl N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)carbamate (PubChem CID 110715870) has the molecular formula C9H12N2O2S
and a molecular weight of 212.27 g/mol. Its IUPAC name is methyl N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)carbamate.
Molecular Properties
| Compound Name | methyl N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)carbamate |
| PubChem CID | 110715870 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | methyl N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)carbamate |
| SMILES | COC(=O)N(Cc1nccs1)C1CC1 |
| InChI | InChI=1S/C9H12N2O2S/c1-13-9(12)11(7-2-3-7)6-8-10-4-5-14-8/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | UYBQUBQGAZOINA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)carbamate?
The IUPAC name of methyl N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)carbamate (CID 110715870) is methyl N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)carbamate.
What is the SMILES notation for methyl N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)carbamate?
The canonical SMILES for methyl N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)carbamate is COC(=O)N(Cc1nccs1)C1CC1.
What is the InChIKey of methyl N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)carbamate?
The InChIKey is UYBQUBQGAZOINA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2S/c1-13-9(12)11(7-2-3-7)6-8-10-4-5-14-8/h4-5,7H,2-3,6H2,1H3.
What are the key properties of methyl N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)carbamate?
methyl N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)carbamate has a molecular weight of 212.27 g/mol, XLogP of 1.87, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-cyclopropyl-N-(1,3-thiazol-2-ylmethyl)carbamate is sourced from PubChem (CID 110715870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).