C25H34O13 — CID 11071618
[(2R,3S,6R)-6-prop-2-enyl-3-[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 11071618) has the molecular formula C25H34O13 and a molecular weight of 542.53 g/mol. Its IUPAC name is [(2R,3S,6R)-6-prop-2-enyl-3-[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6R)-6-prop-2-enyl-3-[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11071618 |
| Molecular Formula | C25H34O13 |
| Molecular Weight | 542.53 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | [(2R,3S,6R)-6-prop-2-enyl-3-[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | C=CC[C@@H]1C=C[C@H](O[C@@H]2O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C25H34O13/c1-7-8-18-9-10-19(20(36-18)11-31-13(2)26)37-25-24(35-17(6)30)23(34-16(5)29)22(33-15(4)28)21(38-25)12-32-14(3)27/h7,9-10,18-25H,1,8,11-12H2,2-6H3/t18-,19+,20-,21-,22+,23+,24-,25-/m1/s1 |
| InChIKey | POMYQVTXPACGCR-PCUAPSFZSA-N |
| XLogP | 0.92 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.53 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|