C29H44O10 — CID 11071724
dimethyl 2-[(2E,4Z)-5-[(1R,2R)-3,3-dimethoxy-2-methoxycarbonylcyclopentyl]penta-2,4-dienyl]-2-[(Z)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-methylbut-3-enyl]propanedioate (PubChem CID 11071724) has the molecular formula C29H44O10 and a molecular weight of 552.66 g/mol. Its IUPAC name is dimethyl 2-[(2E,4Z)-5-[(1R,2R)-3,3-dimethoxy-2-methoxycarbonylcyclopentyl]penta-2,4-dienyl]-2-[(Z)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-methylbut-3-enyl]propanedioate.
| Compound Name | dimethyl 2-[(2E,4Z)-5-[(1R,2R)-3,3-dimethoxy-2-methoxycarbonylcyclopentyl]penta-2,4-dienyl]-2-[(Z)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-methylbut-3-enyl]propanedioate |
|---|---|
| PubChem CID | 11071724 |
| Molecular Formula | C29H44O10 |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | dimethyl 2-[(2E,4Z)-5-[(1R,2R)-3,3-dimethoxy-2-methoxycarbonylcyclopentyl]penta-2,4-dienyl]-2-[(Z)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-methylbut-3-enyl]propanedioate |
| SMILES | COC(=O)[C@@H]1[C@@H](/C=C\C=C\CC(CC/C(C)=C\C2COC(C)(C)O2)(C(=O)OC)C(=O)OC)CCC1(OC)OC |
| InChI | InChI=1S/C29H44O10/c1-20(18-22-19-38-27(2,3)39-22)13-16-28(25(31)34-5,26(32)35-6)15-11-9-10-12-21-14-17-29(36-7,37-8)23(21)24(30)33-4/h9-12,18,21-23H,13-17,19H2,1-8H3/b11-9+,12-10-,20-18-/t21-,22?,23-/m0/s1 |
| InChIKey | WQFSKOXDBXBXOG-GTMOJWKQSA-N |
| XLogP | 3.89 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|