C15H13F3N2OS — CID 110718279
N-cyclopropyl-2,3,4-trifluoro-N-[(2-methyl-1,3-thiazol-4-yl)methyl]benzamide (PubChem CID 110718279) has the molecular formula C15H13F3N2OS and a molecular weight of 326.34 g/mol. Its IUPAC name is N-cyclopropyl-2,3,4-trifluoro-N-[(2-methyl-1,3-thiazol-4-yl)methyl]benzamide.
| Compound Name | N-cyclopropyl-2,3,4-trifluoro-N-[(2-methyl-1,3-thiazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 110718279 |
| Molecular Formula | C15H13F3N2OS |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | N-cyclopropyl-2,3,4-trifluoro-N-[(2-methyl-1,3-thiazol-4-yl)methyl]benzamide |
| SMILES | Cc1nc(CN(C(=O)c2ccc(F)c(F)c2F)C2CC2)cs1 |
| InChI | InChI=1S/C15H13F3N2OS/c1-8-19-9(7-22-8)6-20(10-2-3-10)15(21)11-4-5-12(16)14(18)13(11)17/h4-5,7,10H,2-3,6H2,1H3 |
| InChIKey | YBSOXHGGAZPICT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|