C11H18N2O2 — CID 110718533
3-methyl-N-[2-(2-methyl-1,3-oxazol-4-yl)ethyl]butanamide (PubChem CID 110718533) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-methyl-N-[2-(2-methyl-1,3-oxazol-4-yl)ethyl]butanamide.
| Compound Name | 3-methyl-N-[2-(2-methyl-1,3-oxazol-4-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 110718533 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 3-methyl-N-[2-(2-methyl-1,3-oxazol-4-yl)ethyl]butanamide |
| SMILES | Cc1nc(CCNC(=O)CC(C)C)co1 |
| InChI | InChI=1S/C11H18N2O2/c1-8(2)6-11(14)12-5-4-10-7-15-9(3)13-10/h7-8H,4-6H2,1-3H3,(H,12,14) |
| InChIKey | MUTWHFZVRCZYCS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |