C14H17N3O4 — CID 110719111
N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-2-(4-methylphenoxy)acetamide (PubChem CID 110719111) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-2-(4-methylphenoxy)acetamide.
| Compound Name | N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-2-(4-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 110719111 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]-2-(4-methylphenoxy)acetamide |
| SMILES | Cc1ccc(OCC(=O)NCCN2C(=O)CNC2=O)cc1 |
| InChI | InChI=1S/C14H17N3O4/c1-10-2-4-11(5-3-10)21-9-12(18)15-6-7-17-13(19)8-16-14(17)20/h2-5H,6-9H2,1H3,(H,15,18)(H,16,20) |
| InChIKey | CDQZCPRMSXRGHX-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|