C12H14ClN3O4S — CID 110719194
1-(4-chlorophenyl)-N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]methanesulfonamide (PubChem CID 110719194) has the molecular formula C12H14ClN3O4S and a molecular weight of 331.78 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]methanesulfonamide.
| Compound Name | 1-(4-chlorophenyl)-N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 110719194 |
| Molecular Formula | C12H14ClN3O4S |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[2-(2,5-dioxoimidazolidin-1-yl)ethyl]methanesulfonamide |
| SMILES | O=C1CNC(=O)N1CCNS(=O)(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H14ClN3O4S/c13-10-3-1-9(2-4-10)8-21(19,20)15-5-6-16-11(17)7-14-12(16)18/h1-4,15H,5-8H2,(H,14,18) |
| InChIKey | NXCRCHNEZNQTHA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|