C14H18N2O2S — CID 110719746
N-(1-cyclopropyl-5-oxopyrrolidin-3-yl)-3-thiophen-2-ylpropanamide (PubChem CID 110719746) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is N-(1-cyclopropyl-5-oxopyrrolidin-3-yl)-3-thiophen-2-ylpropanamide.
| Compound Name | N-(1-cyclopropyl-5-oxopyrrolidin-3-yl)-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 110719746 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | N-(1-cyclopropyl-5-oxopyrrolidin-3-yl)-3-thiophen-2-ylpropanamide |
| SMILES | O=C(CCc1cccs1)NC1CC(=O)N(C2CC2)C1 |
| InChI | InChI=1S/C14H18N2O2S/c17-13(6-5-12-2-1-7-19-12)15-10-8-14(18)16(9-10)11-3-4-11/h1-2,7,10-11H,3-6,8-9H2,(H,15,17) |
| InChIKey | CJLJFSGIXSIZII-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |