C31H53NO6Si2 — CID 11072026
(3R,4R,5R,6S)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-4,6-dimethyl-7-oxo-3,5-bis(triethylsilyloxy)heptanal (PubChem CID 11072026) has the molecular formula C31H53NO6Si2 and a molecular weight of 591.94 g/mol. Its IUPAC name is (3R,4R,5R,6S)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-4,6-dimethyl-7-oxo-3,5-bis(triethylsilyloxy)heptanal.
| Compound Name | (3R,4R,5R,6S)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-4,6-dimethyl-7-oxo-3,5-bis(triethylsilyloxy)heptanal |
|---|---|
| PubChem CID | 11072026 |
| Molecular Formula | C31H53NO6Si2 |
| Molecular Weight | 591.94 g/mol |
| Exact Mass | 591.34 |
| IUPAC Name | (3R,4R,5R,6S)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-4,6-dimethyl-7-oxo-3,5-bis(triethylsilyloxy)heptanal |
| SMILES | CC[Si](CC)(CC)O[C@H]([C@H](C)[C@@H](CC=O)O[Si](CC)(CC)CC)[C@H](C)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C31H53NO6Si2/c1-9-39(10-2,11-3)37-28(20-21-33)24(7)29(38-40(12-4,13-5)14-6)25(8)30(34)32-27(23-36-31(32)35)22-26-18-16-15-17-19-26/h15-19,21,24-25,27-29H,9-14,20,22-23H2,1-8H3/t24-,25+,27+,28-,29-/m1/s1 |
| InChIKey | OSZVMQPMOXHDNO-AWUCKFEESA-N |
| XLogP | 7.22 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.94 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|