C16H10ClFN2O4 — CID 110720619
2-chloro-N-[4-(2,4-dioxo-1,3-oxazolidin-5-yl)phenyl]-6-fluorobenzamide (PubChem CID 110720619) has the molecular formula C16H10ClFN2O4 and a molecular weight of 348.72 g/mol. Its IUPAC name is 2-chloro-N-[4-(2,4-dioxo-1,3-oxazolidin-5-yl)phenyl]-6-fluorobenzamide.
| Compound Name | 2-chloro-N-[4-(2,4-dioxo-1,3-oxazolidin-5-yl)phenyl]-6-fluorobenzamide |
|---|---|
| PubChem CID | 110720619 |
| Molecular Formula | C16H10ClFN2O4 |
| Molecular Weight | 348.72 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 2-chloro-N-[4-(2,4-dioxo-1,3-oxazolidin-5-yl)phenyl]-6-fluorobenzamide |
| SMILES | O=C1NC(=O)C(c2ccc(NC(=O)c3c(F)cccc3Cl)cc2)O1 |
| InChI | InChI=1S/C16H10ClFN2O4/c17-10-2-1-3-11(18)12(10)14(21)19-9-6-4-8(5-7-9)13-15(22)20-16(23)24-13/h1-7,13H,(H,19,21)(H,20,22,23) |
| InChIKey | VWKGBNSLCSQNAC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.72 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |