C16H20N2OS — CID 110721301
1-(4-pyrrol-1-ylpiperidin-1-yl)-3-thiophen-2-ylpropan-1-one (PubChem CID 110721301) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is 1-(4-pyrrol-1-ylpiperidin-1-yl)-3-thiophen-2-ylpropan-1-one.
| Compound Name | 1-(4-pyrrol-1-ylpiperidin-1-yl)-3-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 110721301 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1-(4-pyrrol-1-ylpiperidin-1-yl)-3-thiophen-2-ylpropan-1-one |
| SMILES | O=C(CCc1cccs1)N1CCC(n2cccc2)CC1 |
| InChI | InChI=1S/C16H20N2OS/c19-16(6-5-15-4-3-13-20-15)18-11-7-14(8-12-18)17-9-1-2-10-17/h1-4,9-10,13-14H,5-8,11-12H2 |
| InChIKey | KZYSSHNMPBIYHE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |