About 4-[(4-methylphenyl)methylsulfonyl]-1,4-thiazinane 1,1-dioxide
4-[(4-methylphenyl)methylsulfonyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 110721477) has the molecular formula C12H17NO4S2
and a molecular weight of 303.40 g/mol. Its IUPAC name is 4-[(4-methylphenyl)methylsulfonyl]-1,4-thiazinane 1,1-dioxide.
Molecular Properties
| Compound Name | 4-[(4-methylphenyl)methylsulfonyl]-1,4-thiazinane 1,1-dioxide |
| PubChem CID | 110721477 |
| Molecular Formula | C12H17NO4S2 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 4-[(4-methylphenyl)methylsulfonyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | Cc1ccc(CS(=O)(=O)N2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C12H17NO4S2/c1-11-2-4-12(5-3-11)10-19(16,17)13-6-8-18(14,15)9-7-13/h2-5H,6-10H2,1H3 |
| InChIKey | MVCMJAUUYGBKFG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(4-methylphenyl)methylsulfonyl]-1,4-thiazinane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-methylphenyl)methylsulfonyl]-1,4-thiazinane 1,1-dioxide?
The IUPAC name of 4-[(4-methylphenyl)methylsulfonyl]-1,4-thiazinane 1,1-dioxide (CID 110721477) is 4-[(4-methylphenyl)methylsulfonyl]-1,4-thiazinane 1,1-dioxide.
What is the SMILES notation for 4-[(4-methylphenyl)methylsulfonyl]-1,4-thiazinane 1,1-dioxide?
The canonical SMILES for 4-[(4-methylphenyl)methylsulfonyl]-1,4-thiazinane 1,1-dioxide is Cc1ccc(CS(=O)(=O)N2CCS(=O)(=O)CC2)cc1.
What is the InChIKey of 4-[(4-methylphenyl)methylsulfonyl]-1,4-thiazinane 1,1-dioxide?
The InChIKey is MVCMJAUUYGBKFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO4S2/c1-11-2-4-12(5-3-11)10-19(16,17)13-6-8-18(14,15)9-7-13/h2-5H,6-10H2,1H3.
What are the key properties of 4-[(4-methylphenyl)methylsulfonyl]-1,4-thiazinane 1,1-dioxide?
4-[(4-methylphenyl)methylsulfonyl]-1,4-thiazinane 1,1-dioxide has a molecular weight of 303.40 g/mol, XLogP of 0.56, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-methylphenyl)methylsulfonyl]-1,4-thiazinane 1,1-dioxide is sourced from PubChem (CID 110721477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).