C33H48O9Si — CID 11072186
[(1S,2S,3R,4S,7R,9S,10S,12R,15S)-1,4,12,15-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 11072186) has the molecular formula C33H48O9Si and a molecular weight of 616.82 g/mol. Its IUPAC name is [(1S,2S,3R,4S,7R,9S,10S,12R,15S)-1,4,12,15-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | [(1S,2S,3R,4S,7R,9S,10S,12R,15S)-1,4,12,15-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 11072186 |
| Molecular Formula | C33H48O9Si |
| Molecular Weight | 616.82 g/mol |
| Exact Mass | 616.31 |
| IUPAC Name | [(1S,2S,3R,4S,7R,9S,10S,12R,15S)-1,4,12,15-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@H]2OC[C@@]2(O)[C@H]2[C@H](OC(=O)c3ccccc3)[C@]3(O)C[C@H](O)C(C)=C([C@@H](O)C(=O)[C@]12C)C3(C)C |
| InChI | InChI=1S/C33H48O9Si/c1-8-43(9-2,10-3)42-22-16-23-32(38,18-40-23)26-28(41-29(37)20-14-12-11-13-15-20)33(39)17-21(34)19(4)24(30(33,5)6)25(35)27(36)31(22,26)7/h11-15,21-23,25-26,28,34-35,38-39H,8-10,16-18H2,1-7H3/t21-,22-,23+,25+,26-,28-,31+,32-,33+/m0/s1 |
| InChIKey | DNLRTEZSNLNOMC-UVDWMJHKSA-N |
| XLogP | 3.54 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.82 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|