C30H27ClF3N7O3 — CID 11072236
N-[3-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-3-chloro-6-oxo-5-(2-phenylethylamino)pyrazin-2-yl]phenyl]-2,2,2-trifluoroacetamide (PubChem CID 11072236) has the molecular formula C30H27ClF3N7O3 and a molecular weight of 626.04 g/mol. Its IUPAC name is N-[3-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-3-chloro-6-oxo-5-(2-phenylethylamino)pyrazin-2-yl]phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-3-chloro-6-oxo-5-(2-phenylethylamino)pyrazin-2-yl]phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 11072236 |
| Molecular Formula | C30H27ClF3N7O3 |
| Molecular Weight | 626.04 g/mol |
| Exact Mass | 625.18 |
| IUPAC Name | N-[3-[1-[2-[(4-carbamimidoylphenyl)methylamino]-2-oxoethyl]-3-chloro-6-oxo-5-(2-phenylethylamino)pyrazin-2-yl]phenyl]-2,2,2-trifluoroacetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)Cn2c(-c3cccc(NC(=O)C(F)(F)F)c3)c(Cl)nc(NCCc3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C30H27ClF3N7O3/c31-25-24(21-7-4-8-22(15-21)39-29(44)30(32,33)34)41(17-23(42)38-16-19-9-11-20(12-10-19)26(35)36)28(43)27(40-25)37-14-13-18-5-2-1-3-6-18/h1-12,15H,13-14,16-17H2,(H3,35,36)(H,37,40)(H,38,42)(H,39,44) |
| InChIKey | RISTVLHHKSEXTE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 154.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.04 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|