C8H15N5O2S — CID 110722480
N,N,3-trimethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-sulfonamide (PubChem CID 110722480) has the molecular formula C8H15N5O2S and a molecular weight of 245.31 g/mol. Its IUPAC name is N,N,3-trimethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-sulfonamide.
| Compound Name | N,N,3-trimethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-sulfonamide |
|---|---|
| PubChem CID | 110722480 |
| Molecular Formula | C8H15N5O2S |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | N,N,3-trimethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-sulfonamide |
| SMILES | Cc1nnc2n1CCN(S(=O)(=O)N(C)C)C2 |
| InChI | InChI=1S/C8H15N5O2S/c1-7-9-10-8-6-12(4-5-13(7)8)16(14,15)11(2)3/h4-6H2,1-3H3 |
| InChIKey | AHWLUTFYCLGIEN-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |