About ethyl N-[(1-oxo-3,4-dihydro-2H-isoquinolin-4-yl)methyl]carbamate
ethyl N-[(1-oxo-3,4-dihydro-2H-isoquinolin-4-yl)methyl]carbamate (PubChem CID 110723255) has the molecular formula C13H16N2O3
and a molecular weight of 248.28 g/mol. Its IUPAC name is ethyl N-[(1-oxo-3,4-dihydro-2H-isoquinolin-4-yl)methyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(1-oxo-3,4-dihydro-2H-isoquinolin-4-yl)methyl]carbamate |
| PubChem CID | 110723255 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | ethyl N-[(1-oxo-3,4-dihydro-2H-isoquinolin-4-yl)methyl]carbamate |
| SMILES | CCOC(=O)NCC1CNC(=O)c2ccccc21 |
| InChI | InChI=1S/C13H16N2O3/c1-2-18-13(17)15-8-9-7-14-12(16)11-6-4-3-5-10(9)11/h3-6,9H,2,7-8H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | ZLDZPFMSABYAMQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl N-[(1-oxo-3,4-dihydro-2H-isoquinolin-4-yl)methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(1-oxo-3,4-dihydro-2H-isoquinolin-4-yl)methyl]carbamate?
The IUPAC name of ethyl N-[(1-oxo-3,4-dihydro-2H-isoquinolin-4-yl)methyl]carbamate (CID 110723255) is ethyl N-[(1-oxo-3,4-dihydro-2H-isoquinolin-4-yl)methyl]carbamate.
What is the SMILES notation for ethyl N-[(1-oxo-3,4-dihydro-2H-isoquinolin-4-yl)methyl]carbamate?
The canonical SMILES for ethyl N-[(1-oxo-3,4-dihydro-2H-isoquinolin-4-yl)methyl]carbamate is CCOC(=O)NCC1CNC(=O)c2ccccc21.
What is the InChIKey of ethyl N-[(1-oxo-3,4-dihydro-2H-isoquinolin-4-yl)methyl]carbamate?
The InChIKey is ZLDZPFMSABYAMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O3/c1-2-18-13(17)15-8-9-7-14-12(16)11-6-4-3-5-10(9)11/h3-6,9H,2,7-8H2,1H3,(H,14,16)(H,15,17).
What are the key properties of ethyl N-[(1-oxo-3,4-dihydro-2H-isoquinolin-4-yl)methyl]carbamate?
ethyl N-[(1-oxo-3,4-dihydro-2H-isoquinolin-4-yl)methyl]carbamate has a molecular weight of 248.28 g/mol, XLogP of 1.26, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(1-oxo-3,4-dihydro-2H-isoquinolin-4-yl)methyl]carbamate is sourced from PubChem (CID 110723255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).