About phenyl N-methyl-N-(1,3-thiazol-2-yl)carbamate
phenyl N-methyl-N-(1,3-thiazol-2-yl)carbamate (PubChem CID 110723371) has the molecular formula C11H10N2O2S
and a molecular weight of 234.28 g/mol. Its IUPAC name is phenyl N-methyl-N-(1,3-thiazol-2-yl)carbamate.
Molecular Properties
| Compound Name | phenyl N-methyl-N-(1,3-thiazol-2-yl)carbamate |
| PubChem CID | 110723371 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | phenyl N-methyl-N-(1,3-thiazol-2-yl)carbamate |
| SMILES | CN(C(=O)Oc1ccccc1)c1nccs1 |
| InChI | InChI=1S/C11H10N2O2S/c1-13(10-12-7-8-16-10)11(14)15-9-5-3-2-4-6-9/h2-8H,1H3 |
| InChIKey | USUQCRWJDSFUKB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze phenyl N-methyl-N-(1,3-thiazol-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-methyl-N-(1,3-thiazol-2-yl)carbamate?
The IUPAC name of phenyl N-methyl-N-(1,3-thiazol-2-yl)carbamate (CID 110723371) is phenyl N-methyl-N-(1,3-thiazol-2-yl)carbamate.
What is the SMILES notation for phenyl N-methyl-N-(1,3-thiazol-2-yl)carbamate?
The canonical SMILES for phenyl N-methyl-N-(1,3-thiazol-2-yl)carbamate is CN(C(=O)Oc1ccccc1)c1nccs1.
What is the InChIKey of phenyl N-methyl-N-(1,3-thiazol-2-yl)carbamate?
The InChIKey is USUQCRWJDSFUKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2S/c1-13(10-12-7-8-16-10)11(14)15-9-5-3-2-4-6-9/h2-8H,1H3.
What are the key properties of phenyl N-methyl-N-(1,3-thiazol-2-yl)carbamate?
phenyl N-methyl-N-(1,3-thiazol-2-yl)carbamate has a molecular weight of 234.28 g/mol, XLogP of 2.78, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-methyl-N-(1,3-thiazol-2-yl)carbamate is sourced from PubChem (CID 110723371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).