C17H17N3O2S — CID 110723878
N-(2,3-dimethylquinoxalin-6-yl)-2-methylbenzenesulfonamide (PubChem CID 110723878) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is N-(2,3-dimethylquinoxalin-6-yl)-2-methylbenzenesulfonamide.
| Compound Name | N-(2,3-dimethylquinoxalin-6-yl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 110723878 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-(2,3-dimethylquinoxalin-6-yl)-2-methylbenzenesulfonamide |
| SMILES | Cc1ccccc1S(=O)(=O)Nc1ccc2nc(C)c(C)nc2c1 |
| InChI | InChI=1S/C17H17N3O2S/c1-11-6-4-5-7-17(11)23(21,22)20-14-8-9-15-16(10-14)19-13(3)12(2)18-15/h4-10,20H,1-3H3 |
| InChIKey | NJPRIFAOEHFFNP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |