C31H32Cl2O2P2Pd — CID 11072443
dichloropalladium;[(4R,5R)-5-(diphenylphosphanylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl-diphenylphosphane (PubChem CID 11072443) has the molecular formula C31H32Cl2O2P2Pd and a molecular weight of 675.87 g/mol. Its IUPAC name is dichloropalladium;[(4R,5R)-5-(diphenylphosphanylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl-diphenylphosphane.
| Compound Name | dichloropalladium;[(4R,5R)-5-(diphenylphosphanylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl-diphenylphosphane |
|---|---|
| PubChem CID | 11072443 |
| Molecular Formula | C31H32Cl2O2P2Pd |
| Molecular Weight | 675.87 g/mol |
| Exact Mass | 674.03 |
| IUPAC Name | dichloropalladium;[(4R,5R)-5-(diphenylphosphanylmethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl-diphenylphosphane |
| SMILES | CC1(C)O[C@@H](CP(c2ccccc2)c2ccccc2)[C@H](CP(c2ccccc2)c2ccccc2)O1.Cl[Pd]Cl |
| InChI | InChI=1S/C31H32O2P2.2ClH.Pd/c1-31(2)32-29(23-34(25-15-7-3-8-16-25)26-17-9-4-10-18-26)30(33-31)24-35(27-19-11-5-12-20-27)28-21-13-6-14-22-28;;;/h3-22,29-30H,23-24H2,1-2H3;2*1H;/q;;;+2/p-2/t29-,30-;;;/m0.../s1 |
| InChIKey | JUOLXJPDHWWXOF-BPTUYQQTSA-L |
| XLogP | 7.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.87 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|