C38H74O5Si3 — CID 11072522
(Z,5S,12R)-1,5,12-tris[[tert-butyl(dimethyl)silyl]oxy]icos-14-en-7,9-diyne-6,11-diol (PubChem CID 11072522) has the molecular formula C38H74O5Si3 and a molecular weight of 695.26 g/mol. Its IUPAC name is (Z,5S,12R)-1,5,12-tris[[tert-butyl(dimethyl)silyl]oxy]icos-14-en-7,9-diyne-6,11-diol.
| Compound Name | (Z,5S,12R)-1,5,12-tris[[tert-butyl(dimethyl)silyl]oxy]icos-14-en-7,9-diyne-6,11-diol |
|---|---|
| PubChem CID | 11072522 |
| Molecular Formula | C38H74O5Si3 |
| Molecular Weight | 695.26 g/mol |
| Exact Mass | 694.48 |
| IUPAC Name | (Z,5S,12R)-1,5,12-tris[[tert-butyl(dimethyl)silyl]oxy]icos-14-en-7,9-diyne-6,11-diol |
| SMILES | CCCCC/C=C\C[C@@H](O[Si](C)(C)C(C)(C)C)C(O)C#CC#CC(O)[C@H](CCCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H74O5Si3/c1-17-18-19-20-21-22-29-34(42-45(13,14)37(5,6)7)32(39)27-23-24-28-33(40)35(43-46(15,16)38(8,9)10)30-25-26-31-41-44(11,12)36(2,3)4/h21-22,32-35,39-40H,17-20,25-26,29-31H2,1-16H3/b22-21-/t32?,33?,34-,35+/m1/s1 |
| InChIKey | HDYWODGJXFLCPV-YLRRTZFMSA-N |
| XLogP | 10.21 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.26 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|