C19H20N2O3 — CID 110728500
4-[2-(3-methoxyphenyl)acetyl]-3-phenylpiperazin-2-one (PubChem CID 110728500) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 4-[2-(3-methoxyphenyl)acetyl]-3-phenylpiperazin-2-one.
| Compound Name | 4-[2-(3-methoxyphenyl)acetyl]-3-phenylpiperazin-2-one |
|---|---|
| PubChem CID | 110728500 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 4-[2-(3-methoxyphenyl)acetyl]-3-phenylpiperazin-2-one |
| SMILES | COc1cccc(CC(=O)N2CCNC(=O)C2c2ccccc2)c1 |
| InChI | InChI=1S/C19H20N2O3/c1-24-16-9-5-6-14(12-16)13-17(22)21-11-10-20-19(23)18(21)15-7-3-2-4-8-15/h2-9,12,18H,10-11,13H2,1H3,(H,20,23) |
| InChIKey | QJCKWILXGBMQDH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |