C17H16N2O4 — CID 110729632
2-methoxy-N-(6-methyl-3-oxo-4H-1,4-benzoxazin-8-yl)benzamide (PubChem CID 110729632) has the molecular formula C17H16N2O4 and a molecular weight of 312.32 g/mol. Its IUPAC name is 2-methoxy-N-(6-methyl-3-oxo-4H-1,4-benzoxazin-8-yl)benzamide.
| Compound Name | 2-methoxy-N-(6-methyl-3-oxo-4H-1,4-benzoxazin-8-yl)benzamide |
|---|---|
| PubChem CID | 110729632 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-methoxy-N-(6-methyl-3-oxo-4H-1,4-benzoxazin-8-yl)benzamide |
| SMILES | COc1ccccc1C(=O)Nc1cc(C)cc2c1OCC(=O)N2 |
| InChI | InChI=1S/C17H16N2O4/c1-10-7-12-16(23-9-15(20)18-12)13(8-10)19-17(21)11-5-3-4-6-14(11)22-2/h3-8H,9H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | UIPPLQHYNLRNEZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |