C16H22N2O2 — CID 110730062
3,3-dimethyl-N-[2-(2-oxo-3H-indol-1-yl)ethyl]butanamide (PubChem CID 110730062) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 3,3-dimethyl-N-[2-(2-oxo-3H-indol-1-yl)ethyl]butanamide.
| Compound Name | 3,3-dimethyl-N-[2-(2-oxo-3H-indol-1-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 110730062 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 3,3-dimethyl-N-[2-(2-oxo-3H-indol-1-yl)ethyl]butanamide |
| SMILES | CC(C)(C)CC(=O)NCCN1C(=O)Cc2ccccc21 |
| InChI | InChI=1S/C16H22N2O2/c1-16(2,3)11-14(19)17-8-9-18-13-7-5-4-6-12(13)10-15(18)20/h4-7H,8-11H2,1-3H3,(H,17,19) |
| InChIKey | XHFDNAPJCHQZPH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |