C13H11Cl2NO2 — CID 110731633
3,4-dichloro-N-[(5-methylfuran-2-yl)methyl]benzamide (PubChem CID 110731633) has the molecular formula C13H11Cl2NO2 and a molecular weight of 284.14 g/mol. Its IUPAC name is 3,4-dichloro-N-[(5-methylfuran-2-yl)methyl]benzamide.
| Compound Name | 3,4-dichloro-N-[(5-methylfuran-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 110731633 |
| Molecular Formula | C13H11Cl2NO2 |
| Molecular Weight | 284.14 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 3,4-dichloro-N-[(5-methylfuran-2-yl)methyl]benzamide |
| SMILES | Cc1ccc(CNC(=O)c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C13H11Cl2NO2/c1-8-2-4-10(18-8)7-16-13(17)9-3-5-11(14)12(15)6-9/h2-6H,7H2,1H3,(H,16,17) |
| InChIKey | LZBQSUNNWKHEBB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.14 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |