C17H17NO4 — CID 110732808
N-[4-(1,3-dioxolan-2-yl)phenyl]-2-methoxybenzamide (PubChem CID 110732808) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is N-[4-(1,3-dioxolan-2-yl)phenyl]-2-methoxybenzamide.
| Compound Name | N-[4-(1,3-dioxolan-2-yl)phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 110732808 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N-[4-(1,3-dioxolan-2-yl)phenyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1ccc(C2OCCO2)cc1 |
| InChI | InChI=1S/C17H17NO4/c1-20-15-5-3-2-4-14(15)16(19)18-13-8-6-12(7-9-13)17-21-10-11-22-17/h2-9,17H,10-11H2,1H3,(H,18,19) |
| InChIKey | XBWPNAVQTNCGAU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |