C21H13N3O3 — CID 1107337
6-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 1107337) has the molecular formula C21H13N3O3 and a molecular weight of 355.35 g/mol. Its IUPAC name is 6-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 1107337 |
| Molecular Formula | C21H13N3O3 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 6-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | Cc1ccc2oc(-c3cccc(N4C(=O)c5cccnc5C4=O)c3)nc2c1 |
| InChI | InChI=1S/C21H13N3O3/c1-12-7-8-17-16(10-12)23-19(27-17)13-4-2-5-14(11-13)24-20(25)15-6-3-9-22-18(15)21(24)26/h2-11H,1H3 |
| InChIKey | IDDXWIJBRNYNPH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|