About 2-methyl-1,3-oxazole-4-carbaldehyde
2-methyl-1,3-oxazole-4-carbaldehyde (PubChem CID 11073372) has the molecular formula C5H5NO2
and a molecular weight of 111.10 g/mol. Its IUPAC name is 2-methyl-1,3-oxazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 2-methyl-1,3-oxazole-4-carbaldehyde |
| PubChem CID | 11073372 |
| Molecular Formula | C5H5NO2 |
| Molecular Weight | 111.10 g/mol |
| Exact Mass | 111.03 |
| IUPAC Name | 2-methyl-1,3-oxazole-4-carbaldehyde |
| SMILES | Cc1nc(C=O)co1 |
| InChI | InChI=1S/C5H5NO2/c1-4-6-5(2-7)3-8-4/h2-3H,1H3 |
| InChIKey | ARAUEWKXKTYCHZ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.10 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1,3-oxazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,3-oxazole-4-carbaldehyde?
The IUPAC name of 2-methyl-1,3-oxazole-4-carbaldehyde (CID 11073372) is 2-methyl-1,3-oxazole-4-carbaldehyde.
What is the SMILES notation for 2-methyl-1,3-oxazole-4-carbaldehyde?
The canonical SMILES for 2-methyl-1,3-oxazole-4-carbaldehyde is Cc1nc(C=O)co1.
What is the InChIKey of 2-methyl-1,3-oxazole-4-carbaldehyde?
The InChIKey is ARAUEWKXKTYCHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2/c1-4-6-5(2-7)3-8-4/h2-3H,1H3.
What are the key properties of 2-methyl-1,3-oxazole-4-carbaldehyde?
2-methyl-1,3-oxazole-4-carbaldehyde has a molecular weight of 111.10 g/mol, XLogP of 0.80, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,3-oxazole-4-carbaldehyde is sourced from PubChem (CID 11073372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).