About cis-(1R,2S)-cyclopentane-1,2,4-triol
cis-(1R,2S)-cyclopentane-1,2,4-triol (PubChem CID 11073392) has the molecular formula C5H10O3
and a molecular weight of 118.13 g/mol. Its IUPAC name is cis-(1R,2S)-cyclopentane-1,2,4-triol.
Molecular Properties
| Compound Name | cis-(1R,2S)-cyclopentane-1,2,4-triol |
| PubChem CID | 11073392 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | cis-(1R,2S)-cyclopentane-1,2,4-triol |
| SMILES | OC1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C5H10O3/c6-3-1-4(7)5(8)2-3/h3-8H,1-2H2/t3?,4-,5+ |
| InChIKey | XMIAGKTYUJDZNV-NVGWPGHNSA-N |
| XLogP | -1.14 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cis-(1R,2S)-cyclopentane-1,2,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2S)-cyclopentane-1,2,4-triol?
The IUPAC name of cis-(1R,2S)-cyclopentane-1,2,4-triol (CID 11073392) is cis-(1R,2S)-cyclopentane-1,2,4-triol.
What is the SMILES notation for cis-(1R,2S)-cyclopentane-1,2,4-triol?
The canonical SMILES for cis-(1R,2S)-cyclopentane-1,2,4-triol is OC1C[C@@H](O)[C@@H](O)C1.
What is the InChIKey of cis-(1R,2S)-cyclopentane-1,2,4-triol?
The InChIKey is XMIAGKTYUJDZNV-NVGWPGHNSA-N. The full InChI is InChI=1S/C5H10O3/c6-3-1-4(7)5(8)2-3/h3-8H,1-2H2/t3?,4-,5+.
What are the key properties of cis-(1R,2S)-cyclopentane-1,2,4-triol?
cis-(1R,2S)-cyclopentane-1,2,4-triol has a molecular weight of 118.13 g/mol, XLogP of -1.14, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-cyclopentane-1,2,4-triol is sourced from PubChem (CID 11073392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).