C17H17N3O2 — CID 110734959
benzyl N-(2,3-dimethylimidazo[1,2-a]pyridin-6-yl)carbamate (PubChem CID 110734959) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is benzyl N-(2,3-dimethylimidazo[1,2-a]pyridin-6-yl)carbamate.
| Compound Name | benzyl N-(2,3-dimethylimidazo[1,2-a]pyridin-6-yl)carbamate |
|---|---|
| PubChem CID | 110734959 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | benzyl N-(2,3-dimethylimidazo[1,2-a]pyridin-6-yl)carbamate |
| SMILES | Cc1nc2ccc(NC(=O)OCc3ccccc3)cn2c1C |
| InChI | InChI=1S/C17H17N3O2/c1-12-13(2)20-10-15(8-9-16(20)18-12)19-17(21)22-11-14-6-4-3-5-7-14/h3-10H,11H2,1-2H3,(H,19,21) |
| InChIKey | UDBOJNKPUMJMGB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |