About (2S,3S)-3-ethenyl-2-methyl-2,6-dihydropyran-3-ol
(2S,3S)-3-ethenyl-2-methyl-2,6-dihydropyran-3-ol (PubChem CID 11073512) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is (2S,3S)-3-ethenyl-2-methyl-2,6-dihydropyran-3-ol.
Molecular Properties
| Compound Name | (2S,3S)-3-ethenyl-2-methyl-2,6-dihydropyran-3-ol |
| PubChem CID | 11073512 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (2S,3S)-3-ethenyl-2-methyl-2,6-dihydropyran-3-ol |
| SMILES | C=C[C@]1(O)C=CCO[C@H]1C |
| InChI | InChI=1S/C8H12O2/c1-3-8(9)5-4-6-10-7(8)2/h3-5,7,9H,1,6H2,2H3/t7-,8-/m0/s1 |
| InChIKey | WFVMBYZXWUICAA-YUMQZZPRSA-N |
| XLogP | 0.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,3S)-3-ethenyl-2-methyl-2,6-dihydropyran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-3-ethenyl-2-methyl-2,6-dihydropyran-3-ol?
The IUPAC name of (2S,3S)-3-ethenyl-2-methyl-2,6-dihydropyran-3-ol (CID 11073512) is (2S,3S)-3-ethenyl-2-methyl-2,6-dihydropyran-3-ol.
What is the SMILES notation for (2S,3S)-3-ethenyl-2-methyl-2,6-dihydropyran-3-ol?
The canonical SMILES for (2S,3S)-3-ethenyl-2-methyl-2,6-dihydropyran-3-ol is C=C[C@]1(O)C=CCO[C@H]1C.
What is the InChIKey of (2S,3S)-3-ethenyl-2-methyl-2,6-dihydropyran-3-ol?
The InChIKey is WFVMBYZXWUICAA-YUMQZZPRSA-N. The full InChI is InChI=1S/C8H12O2/c1-3-8(9)5-4-6-10-7(8)2/h3-5,7,9H,1,6H2,2H3/t7-,8-/m0/s1.
What are the key properties of (2S,3S)-3-ethenyl-2-methyl-2,6-dihydropyran-3-ol?
(2S,3S)-3-ethenyl-2-methyl-2,6-dihydropyran-3-ol has a molecular weight of 140.18 g/mol, XLogP of 0.88, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-3-ethenyl-2-methyl-2,6-dihydropyran-3-ol is sourced from PubChem (CID 11073512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).