About butane-1-sulfinyl chloride
butane-1-sulfinyl chloride (PubChem CID 11073517) has the molecular formula C4H9ClOS
and a molecular weight of 140.64 g/mol. Its IUPAC name is butane-1-sulfinyl chloride.
Molecular Properties
| Compound Name | butane-1-sulfinyl chloride |
| PubChem CID | 11073517 |
| Molecular Formula | C4H9ClOS |
| Molecular Weight | 140.64 g/mol |
| Exact Mass | 140.01 |
| IUPAC Name | butane-1-sulfinyl chloride |
| SMILES | CCCCS(=O)Cl |
| InChI | InChI=1S/C4H9ClOS/c1-2-3-4-7(5)6/h2-4H2,1H3 |
| InChIKey | LTQJJIHJWKUKKQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.64 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butane-1-sulfinyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1-sulfinyl chloride?
The IUPAC name of butane-1-sulfinyl chloride (CID 11073517) is butane-1-sulfinyl chloride.
What is the SMILES notation for butane-1-sulfinyl chloride?
The canonical SMILES for butane-1-sulfinyl chloride is CCCCS(=O)Cl.
What is the InChIKey of butane-1-sulfinyl chloride?
The InChIKey is LTQJJIHJWKUKKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9ClOS/c1-2-3-4-7(5)6/h2-4H2,1H3.
What are the key properties of butane-1-sulfinyl chloride?
butane-1-sulfinyl chloride has a molecular weight of 140.64 g/mol, XLogP of 1.69, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1-sulfinyl chloride is sourced from PubChem (CID 11073517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).