About 4-methyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one
4-methyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one (PubChem CID 11073525) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is 4-methyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one.
Analyze 4-methyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one?
The IUPAC name of 4-methyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one (CID 11073525) is 4-methyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one.
What is the SMILES notation for 4-methyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one?
The canonical SMILES for 4-methyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one is CC1C(=O)OC2OCCC21.
What is the InChIKey of 4-methyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one?
The InChIKey is QCIQCCRPCAWLFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3/c1-4-5-2-3-9-7(5)10-6(4)8/h4-5,7H,2-3H2,1H3.
What are the key properties of 4-methyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one?
4-methyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one has a molecular weight of 142.15 g/mol, XLogP of 0.54, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one is sourced from PubChem (CID 11073525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).