About 3-prop-2-ynoxyphenol
3-prop-2-ynoxyphenol (PubChem CID 11073569) has the molecular formula C9H8O2
and a molecular weight of 148.16 g/mol. Its IUPAC name is 3-prop-2-ynoxyphenol.
Molecular Properties
| Compound Name | 3-prop-2-ynoxyphenol |
| PubChem CID | 11073569 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | 3-prop-2-ynoxyphenol |
| SMILES | C#CCOc1cccc(O)c1 |
| InChI | InChI=1S/C9H8O2/c1-2-6-11-9-5-3-4-8(10)7-9/h1,3-5,7,10H,6H2 |
| InChIKey | FTDMYZWKKGITHT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-2-ynoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-2-ynoxyphenol?
The IUPAC name of 3-prop-2-ynoxyphenol (CID 11073569) is 3-prop-2-ynoxyphenol.
What is the SMILES notation for 3-prop-2-ynoxyphenol?
The canonical SMILES for 3-prop-2-ynoxyphenol is C#CCOc1cccc(O)c1.
What is the InChIKey of 3-prop-2-ynoxyphenol?
The InChIKey is FTDMYZWKKGITHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2/c1-2-6-11-9-5-3-4-8(10)7-9/h1,3-5,7,10H,6H2.
What are the key properties of 3-prop-2-ynoxyphenol?
3-prop-2-ynoxyphenol has a molecular weight of 148.16 g/mol, XLogP of 1.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-2-ynoxyphenol is sourced from PubChem (CID 11073569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).