About 4-diazonio-2,6-dimethylphenolate
4-diazonio-2,6-dimethylphenolate (PubChem CID 11073572) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is 4-diazonio-2,6-dimethylphenolate.
Molecular Properties
| Compound Name | 4-diazonio-2,6-dimethylphenolate |
| PubChem CID | 11073572 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 4-diazonio-2,6-dimethylphenolate |
| SMILES | Cc1cc([N+]#N)cc(C)c1[O-] |
| InChI | InChI=1S/C8H8N2O/c1-5-3-7(10-9)4-6(2)8(5)11/h3-4H,1-2H3 |
| InChIKey | FDJXHMXREUSGSY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-diazonio-2,6-dimethylphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diazonio-2,6-dimethylphenolate?
The IUPAC name of 4-diazonio-2,6-dimethylphenolate (CID 11073572) is 4-diazonio-2,6-dimethylphenolate.
What is the SMILES notation for 4-diazonio-2,6-dimethylphenolate?
The canonical SMILES for 4-diazonio-2,6-dimethylphenolate is Cc1cc([N+]#N)cc(C)c1[O-].
What is the InChIKey of 4-diazonio-2,6-dimethylphenolate?
The InChIKey is FDJXHMXREUSGSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c1-5-3-7(10-9)4-6(2)8(5)11/h3-4H,1-2H3.
What are the key properties of 4-diazonio-2,6-dimethylphenolate?
4-diazonio-2,6-dimethylphenolate has a molecular weight of 148.16 g/mol, XLogP of 1.86, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diazonio-2,6-dimethylphenolate is sourced from PubChem (CID 11073572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).