C10H16O — CID 11073613
(2R)-2-methyl-3,4,5,6,7,8-hexahydro-2H-chromene (PubChem CID 11073613) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (2R)-2-methyl-3,4,5,6,7,8-hexahydro-2H-chromene.
| Compound Name | (2R)-2-methyl-3,4,5,6,7,8-hexahydro-2H-chromene |
|---|---|
| PubChem CID | 11073613 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (2R)-2-methyl-3,4,5,6,7,8-hexahydro-2H-chromene |
| SMILES | C[C@@H]1CCC2=C(CCCC2)O1 |
| InChI | InChI=1S/C10H16O/c1-8-6-7-9-4-2-3-5-10(9)11-8/h8H,2-7H2,1H3/t8-/m1/s1 |
| InChIKey | XQLRYFYGLSLPOZ-MRVPVSSYSA-N |
| XLogP | 3.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |