About (3S,5R)-1-azatricyclo[3.3.1.13,7]decan-4-amine
(3S,5R)-1-azatricyclo[3.3.1.13,7]decan-4-amine (PubChem CID 11073616) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is (3S,5R)-1-azatricyclo[3.3.1.13,7]decan-4-amine.
Molecular Properties
| Compound Name | (3S,5R)-1-azatricyclo[3.3.1.13,7]decan-4-amine |
| PubChem CID | 11073616 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (3S,5R)-1-azatricyclo[3.3.1.13,7]decan-4-amine |
| SMILES | NC1[C@@H]2CC3C[C@H]1CN(C3)C2 |
| InChI | InChI=1S/C9H16N2/c10-9-7-1-6-2-8(9)5-11(3-6)4-7/h6-9H,1-5,10H2/t6?,7-,8+,9? |
| InChIKey | KBANJTYDXMCGKU-VGKQMMLZSA-N |
| XLogP | 0.29 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,5R)-1-azatricyclo[3.3.1.13,7]decan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5R)-1-azatricyclo[3.3.1.13,7]decan-4-amine?
The IUPAC name of (3S,5R)-1-azatricyclo[3.3.1.13,7]decan-4-amine (CID 11073616) is (3S,5R)-1-azatricyclo[3.3.1.13,7]decan-4-amine.
What is the SMILES notation for (3S,5R)-1-azatricyclo[3.3.1.13,7]decan-4-amine?
The canonical SMILES for (3S,5R)-1-azatricyclo[3.3.1.13,7]decan-4-amine is NC1[C@@H]2CC3C[C@H]1CN(C3)C2.
What is the InChIKey of (3S,5R)-1-azatricyclo[3.3.1.13,7]decan-4-amine?
The InChIKey is KBANJTYDXMCGKU-VGKQMMLZSA-N. The full InChI is InChI=1S/C9H16N2/c10-9-7-1-6-2-8(9)5-11(3-6)4-7/h6-9H,1-5,10H2/t6?,7-,8+,9?.
What are the key properties of (3S,5R)-1-azatricyclo[3.3.1.13,7]decan-4-amine?
(3S,5R)-1-azatricyclo[3.3.1.13,7]decan-4-amine has a molecular weight of 152.24 g/mol, XLogP of 0.29, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5R)-1-azatricyclo[3.3.1.13,7]decan-4-amine is sourced from PubChem (CID 11073616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).