C13H15Cl2NO2 — CID 110736396
2,4-dichloro-N-(oxan-4-ylmethyl)benzamide (PubChem CID 110736396) has the molecular formula C13H15Cl2NO2 and a molecular weight of 288.17 g/mol. Its IUPAC name is 2,4-dichloro-N-(oxan-4-ylmethyl)benzamide.
| Compound Name | 2,4-dichloro-N-(oxan-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 110736396 |
| Molecular Formula | C13H15Cl2NO2 |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 2,4-dichloro-N-(oxan-4-ylmethyl)benzamide |
| SMILES | O=C(NCC1CCOCC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H15Cl2NO2/c14-10-1-2-11(12(15)7-10)13(17)16-8-9-3-5-18-6-4-9/h1-2,7,9H,3-6,8H2,(H,16,17) |
| InChIKey | FGIQYJCVKJNDFA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |