C14H18N2O5S — CID 110736456
3-methyl-N-(oxan-4-ylmethyl)-2-oxo-1,3-benzoxazole-6-sulfonamide (PubChem CID 110736456) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is 3-methyl-N-(oxan-4-ylmethyl)-2-oxo-1,3-benzoxazole-6-sulfonamide.
| Compound Name | 3-methyl-N-(oxan-4-ylmethyl)-2-oxo-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 110736456 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 3-methyl-N-(oxan-4-ylmethyl)-2-oxo-1,3-benzoxazole-6-sulfonamide |
| SMILES | Cn1c(=O)oc2cc(S(=O)(=O)NCC3CCOCC3)ccc21 |
| InChI | InChI=1S/C14H18N2O5S/c1-16-12-3-2-11(8-13(12)21-14(16)17)22(18,19)15-9-10-4-6-20-7-5-10/h2-3,8,10,15H,4-7,9H2,1H3 |
| InChIKey | BREDSUXGXVPXSV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |