C11H14N2O3S — CID 110736572
N-(1-methyl-5-oxopyrrolidin-3-yl)benzenesulfonamide (PubChem CID 110736572) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is N-(1-methyl-5-oxopyrrolidin-3-yl)benzenesulfonamide.
| Compound Name | N-(1-methyl-5-oxopyrrolidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 110736572 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | N-(1-methyl-5-oxopyrrolidin-3-yl)benzenesulfonamide |
| SMILES | CN1CC(NS(=O)(=O)c2ccccc2)CC1=O |
| InChI | InChI=1S/C11H14N2O3S/c1-13-8-9(7-11(13)14)12-17(15,16)10-5-3-2-4-6-10/h2-6,9,12H,7-8H2,1H3 |
| InChIKey | WTCSSLQZKOLXBR-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |