About lithium dimethoxymethylbenzene
lithium dimethoxymethylbenzene (PubChem CID 11073687) has the molecular formula C9H11LiO2
and a molecular weight of 158.13 g/mol. Its IUPAC name is lithium dimethoxymethylbenzene.
Molecular Properties
| Compound Name | lithium dimethoxymethylbenzene |
| PubChem CID | 11073687 |
| Molecular Formula | C9H11LiO2 |
| Molecular Weight | 158.13 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | lithium dimethoxymethylbenzene |
| SMILES | COC(OC)c1cc[c-]cc1.[Li+] |
| InChI | InChI=1S/C9H11O2.Li/c1-10-9(11-2)8-6-4-3-5-7-8;/h4-7,9H,1-2H3;/q-1;+1 |
| InChIKey | SFFHNICLKGJBCK-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.13 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze lithium dimethoxymethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium dimethoxymethylbenzene?
The IUPAC name of lithium dimethoxymethylbenzene (CID 11073687) is lithium dimethoxymethylbenzene.
What is the SMILES notation for lithium dimethoxymethylbenzene?
The canonical SMILES for lithium dimethoxymethylbenzene is COC(OC)c1cc[c-]cc1.[Li+].
What is the InChIKey of lithium dimethoxymethylbenzene?
The InChIKey is SFFHNICLKGJBCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11O2.Li/c1-10-9(11-2)8-6-4-3-5-7-8;/h4-7,9H,1-2H3;/q-1;+1.
What are the key properties of lithium dimethoxymethylbenzene?
lithium dimethoxymethylbenzene has a molecular weight of 158.13 g/mol, XLogP of -1.22, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium dimethoxymethylbenzene is sourced from PubChem (CID 11073687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).