About (2E,6E)-2,6-dimethylocta-2,6-dienedial
(2E,6E)-2,6-dimethylocta-2,6-dienedial (PubChem CID 11073781) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is (2E,6E)-2,6-dimethylocta-2,6-dienedial.
Molecular Properties
| Compound Name | (2E,6E)-2,6-dimethylocta-2,6-dienedial |
| PubChem CID | 11073781 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (2E,6E)-2,6-dimethylocta-2,6-dienedial |
| SMILES | C/C(C=O)=C\CC/C(C)=C/C=O |
| InChI | InChI=1S/C10H14O2/c1-9(6-7-11)4-3-5-10(2)8-12/h5-8H,3-4H2,1-2H3/b9-6+,10-5+ |
| InChIKey | GRHWFPUCRVCMRY-TXFIJWAUSA-N |
| XLogP | 2.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E,6E)-2,6-dimethylocta-2,6-dienedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,6E)-2,6-dimethylocta-2,6-dienedial?
The IUPAC name of (2E,6E)-2,6-dimethylocta-2,6-dienedial (CID 11073781) is (2E,6E)-2,6-dimethylocta-2,6-dienedial.
What is the SMILES notation for (2E,6E)-2,6-dimethylocta-2,6-dienedial?
The canonical SMILES for (2E,6E)-2,6-dimethylocta-2,6-dienedial is C/C(C=O)=C\CC/C(C)=C/C=O.
What is the InChIKey of (2E,6E)-2,6-dimethylocta-2,6-dienedial?
The InChIKey is GRHWFPUCRVCMRY-TXFIJWAUSA-N. The full InChI is InChI=1S/C10H14O2/c1-9(6-7-11)4-3-5-10(2)8-12/h5-8H,3-4H2,1-2H3/b9-6+,10-5+.
What are the key properties of (2E,6E)-2,6-dimethylocta-2,6-dienedial?
(2E,6E)-2,6-dimethylocta-2,6-dienedial has a molecular weight of 166.22 g/mol, XLogP of 2.06, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,6E)-2,6-dimethylocta-2,6-dienedial is sourced from PubChem (CID 11073781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).