C10H16O2 — CID 11073823
(2R,4S)-2-ethenyl-2,4-dimethyl-4-prop-2-enyl-1,3-dioxolane (PubChem CID 11073823) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (2R,4S)-2-ethenyl-2,4-dimethyl-4-prop-2-enyl-1,3-dioxolane.
| Compound Name | (2R,4S)-2-ethenyl-2,4-dimethyl-4-prop-2-enyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11073823 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (2R,4S)-2-ethenyl-2,4-dimethyl-4-prop-2-enyl-1,3-dioxolane |
| SMILES | C=CC[C@@]1(C)CO[C@@](C)(C=C)O1 |
| InChI | InChI=1S/C10H16O2/c1-5-7-9(3)8-11-10(4,6-2)12-9/h5-6H,1-2,7-8H2,3-4H3/t9-,10+/m0/s1 |
| InChIKey | RVRHIVZWFMTORR-VHSXEESVSA-N |
| XLogP | 2.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|