C10H17NO2 — CID 110739939
cyclohexyl(1,3-oxazolidin-3-yl)methanone (PubChem CID 110739939) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is cyclohexyl(1,3-oxazolidin-3-yl)methanone.
| Compound Name | cyclohexyl(1,3-oxazolidin-3-yl)methanone |
|---|---|
| PubChem CID | 110739939 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | cyclohexyl(1,3-oxazolidin-3-yl)methanone |
| SMILES | O=C(C1CCCCC1)N1CCOC1 |
| InChI | InChI=1S/C10H17NO2/c12-10(11-6-7-13-8-11)9-4-2-1-3-5-9/h9H,1-8H2 |
| InChIKey | VUGRLUGJQZMHBQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |