About 2,7-dihydroxy-4H-1,4-benzoxazin-3-one
2,7-dihydroxy-4H-1,4-benzoxazin-3-one (PubChem CID 11074014) has the molecular formula C8H7NO4
and a molecular weight of 181.15 g/mol. Its IUPAC name is 2,7-dihydroxy-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 2,7-dihydroxy-4H-1,4-benzoxazin-3-one |
| PubChem CID | 11074014 |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 2,7-dihydroxy-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1Nc2ccc(O)cc2OC1O |
| InChI | InChI=1S/C8H7NO4/c10-4-1-2-5-6(3-4)13-8(12)7(11)9-5/h1-3,8,10,12H,(H,9,11) |
| InChIKey | HDRDOKTYPONKPM-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2,7-dihydroxy-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dihydroxy-4H-1,4-benzoxazin-3-one?
The IUPAC name of 2,7-dihydroxy-4H-1,4-benzoxazin-3-one (CID 11074014) is 2,7-dihydroxy-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 2,7-dihydroxy-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 2,7-dihydroxy-4H-1,4-benzoxazin-3-one is O=C1Nc2ccc(O)cc2OC1O.
What is the InChIKey of 2,7-dihydroxy-4H-1,4-benzoxazin-3-one?
The InChIKey is HDRDOKTYPONKPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO4/c10-4-1-2-5-6(3-4)13-8(12)7(11)9-5/h1-3,8,10,12H,(H,9,11).
What are the key properties of 2,7-dihydroxy-4H-1,4-benzoxazin-3-one?
2,7-dihydroxy-4H-1,4-benzoxazin-3-one has a molecular weight of 181.15 g/mol, XLogP of 0.04, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dihydroxy-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 11074014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).