C22H19N3O3S — CID 1107403
4-cyano-3-methyl-N-(2-methylphenyl)-5-[(2-phenoxyacetyl)amino]thiophene-2-carboxamide (PubChem CID 1107403) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is 4-cyano-3-methyl-N-(2-methylphenyl)-5-[(2-phenoxyacetyl)amino]thiophene-2-carboxamide.
| Compound Name | 4-cyano-3-methyl-N-(2-methylphenyl)-5-[(2-phenoxyacetyl)amino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 1107403 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 4-cyano-3-methyl-N-(2-methylphenyl)-5-[(2-phenoxyacetyl)amino]thiophene-2-carboxamide |
| SMILES | Cc1ccccc1NC(=O)c1sc(NC(=O)COc2ccccc2)c(C#N)c1C |
| InChI | InChI=1S/C22H19N3O3S/c1-14-8-6-7-11-18(14)24-21(27)20-15(2)17(12-23)22(29-20)25-19(26)13-28-16-9-4-3-5-10-16/h3-11H,13H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | MDJIHKQIBYSRJG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |