C18H19NO2 — CID 110740541
1-(2-methyl-5-phenyl-1,3-oxazolidin-3-yl)-2-phenylethanone (PubChem CID 110740541) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-(2-methyl-5-phenyl-1,3-oxazolidin-3-yl)-2-phenylethanone.
| Compound Name | 1-(2-methyl-5-phenyl-1,3-oxazolidin-3-yl)-2-phenylethanone |
|---|---|
| PubChem CID | 110740541 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1-(2-methyl-5-phenyl-1,3-oxazolidin-3-yl)-2-phenylethanone |
| SMILES | CC1OC(c2ccccc2)CN1C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c1-14-19(18(20)12-15-8-4-2-5-9-15)13-17(21-14)16-10-6-3-7-11-16/h2-11,14,17H,12-13H2,1H3 |
| InChIKey | KXDRRQHLPZXNEU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |