C8H18N2O3S — CID 110740865
N,N,2,4,4-pentamethyl-1,3-oxazolidine-3-sulfonamide (PubChem CID 110740865) has the molecular formula C8H18N2O3S and a molecular weight of 222.31 g/mol. Its IUPAC name is N,N,2,4,4-pentamethyl-1,3-oxazolidine-3-sulfonamide.
| Compound Name | N,N,2,4,4-pentamethyl-1,3-oxazolidine-3-sulfonamide |
|---|---|
| PubChem CID | 110740865 |
| Molecular Formula | C8H18N2O3S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | N,N,2,4,4-pentamethyl-1,3-oxazolidine-3-sulfonamide |
| SMILES | CC1OCC(C)(C)N1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C8H18N2O3S/c1-7-10(8(2,3)6-13-7)14(11,12)9(4)5/h7H,6H2,1-5H3 |
| InChIKey | OUHKSHULLHOWMV-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |