About 3-[(E)-2-(1-methyl-4,5-dihydroimidazol-2-yl)ethenyl]pyridine
3-[(E)-2-(1-methyl-4,5-dihydroimidazol-2-yl)ethenyl]pyridine (PubChem CID 11074146) has the molecular formula C11H13N3
and a molecular weight of 187.25 g/mol. Its IUPAC name is 3-[(E)-2-(1-methyl-4,5-dihydroimidazol-2-yl)ethenyl]pyridine.
Molecular Properties
| Compound Name | 3-[(E)-2-(1-methyl-4,5-dihydroimidazol-2-yl)ethenyl]pyridine |
| PubChem CID | 11074146 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 3-[(E)-2-(1-methyl-4,5-dihydroimidazol-2-yl)ethenyl]pyridine |
| SMILES | CN1CCN=C1/C=C/c1cccnc1 |
| InChI | InChI=1S/C11H13N3/c1-14-8-7-13-11(14)5-4-10-3-2-6-12-9-10/h2-6,9H,7-8H2,1H3/b5-4+ |
| InChIKey | NZLRIWYSJLCXEW-SNAWJCMRSA-N |
| XLogP | 1.44 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(E)-2-(1-methyl-4,5-dihydroimidazol-2-yl)ethenyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-2-(1-methyl-4,5-dihydroimidazol-2-yl)ethenyl]pyridine?
The IUPAC name of 3-[(E)-2-(1-methyl-4,5-dihydroimidazol-2-yl)ethenyl]pyridine (CID 11074146) is 3-[(E)-2-(1-methyl-4,5-dihydroimidazol-2-yl)ethenyl]pyridine.
What is the SMILES notation for 3-[(E)-2-(1-methyl-4,5-dihydroimidazol-2-yl)ethenyl]pyridine?
The canonical SMILES for 3-[(E)-2-(1-methyl-4,5-dihydroimidazol-2-yl)ethenyl]pyridine is CN1CCN=C1/C=C/c1cccnc1.
What is the InChIKey of 3-[(E)-2-(1-methyl-4,5-dihydroimidazol-2-yl)ethenyl]pyridine?
The InChIKey is NZLRIWYSJLCXEW-SNAWJCMRSA-N. The full InChI is InChI=1S/C11H13N3/c1-14-8-7-13-11(14)5-4-10-3-2-6-12-9-10/h2-6,9H,7-8H2,1H3/b5-4+.
What are the key properties of 3-[(E)-2-(1-methyl-4,5-dihydroimidazol-2-yl)ethenyl]pyridine?
3-[(E)-2-(1-methyl-4,5-dihydroimidazol-2-yl)ethenyl]pyridine has a molecular weight of 187.25 g/mol, XLogP of 1.44, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-2-(1-methyl-4,5-dihydroimidazol-2-yl)ethenyl]pyridine is sourced from PubChem (CID 11074146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).