About 5,7-Dichloropyrazolo[1,5-a]pyrimidine
5,7-Dichloropyrazolo[1,5-a]pyrimidine (PubChem CID 11074154) has the molecular formula C6H3Cl2N3
and a molecular weight of 188.01 g/mol. Its IUPAC name is 5,7-dichloropyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 5,7-Dichloropyrazolo[1,5-a]pyrimidine |
| PubChem CID | 11074154 |
| Molecular Formula | C6H3Cl2N3 |
| Molecular Weight | 188.01 g/mol |
| Exact Mass | 186.97 |
| IUPAC Name | 5,7-dichloropyrazolo[1,5-a]pyrimidine |
| SMILES | C1=C2N=C(C=C(N2N=C1)Cl)Cl |
| InChI | InChI=1S/C6H3Cl2N3/c7-4-3-5(8)11-6(10-4)1-2-9-11/h1-3H |
| InChIKey | JMTFWCYVZOFHLR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 30.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | 155 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.01 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7-Dichloropyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-Dichloropyrazolo[1,5-a]pyrimidine?
The IUPAC name of 5,7-Dichloropyrazolo[1,5-a]pyrimidine (CID 11074154) is 5,7-dichloropyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 5,7-Dichloropyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 5,7-Dichloropyrazolo[1,5-a]pyrimidine is C1=C2N=C(C=C(N2N=C1)Cl)Cl.
What is the InChIKey of 5,7-Dichloropyrazolo[1,5-a]pyrimidine?
The InChIKey is JMTFWCYVZOFHLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl2N3/c7-4-3-5(8)11-6(10-4)1-2-9-11/h1-3H.
What are the key properties of 5,7-Dichloropyrazolo[1,5-a]pyrimidine?
5,7-Dichloropyrazolo[1,5-a]pyrimidine has a molecular weight of 188.01 g/mol, XLogP of 2.20, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-Dichloropyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 11074154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).