C10H16F2O — CID 11074197
4,4-difluoro-3,5,5-trimethylhepta-1,6-dien-3-ol (PubChem CID 11074197) has the molecular formula C10H16F2O and a molecular weight of 190.23 g/mol. Its IUPAC name is 4,4-difluoro-3,5,5-trimethylhepta-1,6-dien-3-ol.
| Compound Name | 4,4-difluoro-3,5,5-trimethylhepta-1,6-dien-3-ol |
|---|---|
| PubChem CID | 11074197 |
| Molecular Formula | C10H16F2O |
| Molecular Weight | 190.23 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 4,4-difluoro-3,5,5-trimethylhepta-1,6-dien-3-ol |
| SMILES | C=CC(C)(C)C(F)(F)C(C)(O)C=C |
| InChI | InChI=1S/C10H16F2O/c1-6-8(3,4)10(11,12)9(5,13)7-2/h6-7,13H,1-2H2,3-5H3 |
| InChIKey | JHCKLXVDWFSFRC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|